C16H18N6 — CID 100640999
6-(5-amino-3-methylpyrazol-1-yl)-N-benzyl-N-methylpyrimidin-4-amine (PubChem CID 100640999) has the molecular formula C16H18N6 and a molecular weight of 294.36 g/mol. Its IUPAC name is 6-(5-amino-3-methylpyrazol-1-yl)-N-benzyl-N-methylpyrimidin-4-amine.
| Compound Name | 6-(5-amino-3-methylpyrazol-1-yl)-N-benzyl-N-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 100640999 |
| Molecular Formula | C16H18N6 |
| Molecular Weight | 294.36 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | 6-(5-amino-3-methylpyrazol-1-yl)-N-benzyl-N-methylpyrimidin-4-amine |
| SMILES | Cc1cc(N)n(-c2cc(N(C)Cc3ccccc3)ncn2)n1 |
| InChI | InChI=1S/C16H18N6/c1-12-8-14(17)22(20-12)16-9-15(18-11-19-16)21(2)10-13-6-4-3-5-7-13/h3-9,11H,10,17H2,1-2H3 |
| InChIKey | XQHNLKFFFPSDKT-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 72.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.36 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |