C17H21N5O — CID 112858208
4-[6-[benzyl(methyl)amino]pyrimidin-4-yl]piperazine-1-carbaldehyde (PubChem CID 112858208) has the molecular formula C17H21N5O and a molecular weight of 311.39 g/mol. Its IUPAC name is 4-[6-[benzyl(methyl)amino]pyrimidin-4-yl]piperazine-1-carbaldehyde.
| Compound Name | 4-[6-[benzyl(methyl)amino]pyrimidin-4-yl]piperazine-1-carbaldehyde |
|---|---|
| PubChem CID | 112858208 |
| Molecular Formula | C17H21N5O |
| Molecular Weight | 311.39 g/mol |
| Exact Mass | 311.17 |
| IUPAC Name | 4-[6-[benzyl(methyl)amino]pyrimidin-4-yl]piperazine-1-carbaldehyde |
| SMILES | CN(Cc1ccccc1)c1cc(N2CCN(C=O)CC2)ncn1 |
| InChI | InChI=1S/C17H21N5O/c1-20(12-15-5-3-2-4-6-15)16-11-17(19-13-18-16)22-9-7-21(14-23)8-10-22/h2-6,11,13-14H,7-10,12H2,1H3 |
| InChIKey | UHPKKMGJAAQAOS-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 52.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.39 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|