C23H33N3O3 — CID 100645927
tert-butyl (2S)-2-[[3-[(dimethylamino)methyl]phenyl]methylcarbamoyl]-2-prop-2-ynylpyrrolidine-1-carboxylate (PubChem CID 100645927) has the molecular formula C23H33N3O3 and a molecular weight of 399.54 g/mol. Its IUPAC name is tert-butyl (2S)-2-[[3-[(dimethylamino)methyl]phenyl]methylcarbamoyl]-2-prop-2-ynylpyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-[[3-[(dimethylamino)methyl]phenyl]methylcarbamoyl]-2-prop-2-ynylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 100645927 |
| Molecular Formula | C23H33N3O3 |
| Molecular Weight | 399.54 g/mol |
| Exact Mass | 399.25 |
| IUPAC Name | tert-butyl (2S)-2-[[3-[(dimethylamino)methyl]phenyl]methylcarbamoyl]-2-prop-2-ynylpyrrolidine-1-carboxylate |
| SMILES | C#CC[C@]1(C(=O)NCc2cccc(CN(C)C)c2)CCCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H33N3O3/c1-7-12-23(13-9-14-26(23)21(28)29-22(2,3)4)20(27)24-16-18-10-8-11-19(15-18)17-25(5)6/h1,8,10-11,15H,9,12-14,16-17H2,2-6H3,(H,24,27)/t23-/m1/s1 |
| InChIKey | LZCMOIVXBNDODP-HSZRJFAPSA-N |
| XLogP | 3.16 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.54 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|