C18H30N2O4 — CID 100647271
tert-butyl (2R)-2-[[(2R)-2-hydroxy-3-methylbutyl]carbamoyl]-2-prop-2-ynylpyrrolidine-1-carboxylate (PubChem CID 100647271) has the molecular formula C18H30N2O4 and a molecular weight of 338.45 g/mol. Its IUPAC name is tert-butyl (2R)-2-[[(2R)-2-hydroxy-3-methylbutyl]carbamoyl]-2-prop-2-ynylpyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2R)-2-[[(2R)-2-hydroxy-3-methylbutyl]carbamoyl]-2-prop-2-ynylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 100647271 |
| Molecular Formula | C18H30N2O4 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.22 |
| IUPAC Name | tert-butyl (2R)-2-[[(2R)-2-hydroxy-3-methylbutyl]carbamoyl]-2-prop-2-ynylpyrrolidine-1-carboxylate |
| SMILES | C#CC[C@@]1(C(=O)NC[C@H](O)C(C)C)CCCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H30N2O4/c1-7-9-18(15(22)19-12-14(21)13(2)3)10-8-11-20(18)16(23)24-17(4,5)6/h1,13-14,21H,8-12H2,2-6H3,(H,19,22)/t14-,18-/m0/s1 |
| InChIKey | KBDONDSSCTTXBV-KSSFIOAISA-N |
| XLogP | 1.91 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|