C16H17Cl2N3O2 — CID 100647300
5-amino-2-(2,4-dichloroanilino)-N-(2-methoxyethyl)benzamide (PubChem CID 100647300) has the molecular formula C16H17Cl2N3O2 and a molecular weight of 354.24 g/mol. Its IUPAC name is 5-amino-2-(2,4-dichloroanilino)-N-(2-methoxyethyl)benzamide.
| Compound Name | 5-amino-2-(2,4-dichloroanilino)-N-(2-methoxyethyl)benzamide |
|---|---|
| PubChem CID | 100647300 |
| Molecular Formula | C16H17Cl2N3O2 |
| Molecular Weight | 354.24 g/mol |
| Exact Mass | 353.07 |
| IUPAC Name | 5-amino-2-(2,4-dichloroanilino)-N-(2-methoxyethyl)benzamide |
| SMILES | COCCNC(=O)c1cc(N)ccc1Nc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H17Cl2N3O2/c1-23-7-6-20-16(22)12-9-11(19)3-5-14(12)21-15-4-2-10(17)8-13(15)18/h2-5,8-9,21H,6-7,19H2,1H3,(H,20,22) |
| InChIKey | OVUHWPIHQPPGOV-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.24 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|