C13H18BrN3O3 — CID 100649732
(2R)-2-[(4-bromo-3-nitrophenyl)methylamino]-3,3-dimethylbutanamide (PubChem CID 100649732) has the molecular formula C13H18BrN3O3 and a molecular weight of 344.21 g/mol. Its IUPAC name is (2R)-2-[(4-bromo-3-nitrophenyl)methylamino]-3,3-dimethylbutanamide.
| Compound Name | (2R)-2-[(4-bromo-3-nitrophenyl)methylamino]-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 100649732 |
| Molecular Formula | C13H18BrN3O3 |
| Molecular Weight | 344.21 g/mol |
| Exact Mass | 343.05 |
| IUPAC Name | (2R)-2-[(4-bromo-3-nitrophenyl)methylamino]-3,3-dimethylbutanamide |
| SMILES | CC(C)(C)[C@@H](NCc1ccc(Br)c([N+](=O)[O-])c1)C(N)=O |
| InChI | InChI=1S/C13H18BrN3O3/c1-13(2,3)11(12(15)18)16-7-8-4-5-9(14)10(6-8)17(19)20/h4-6,11,16H,7H2,1-3H3,(H2,15,18)/t11-/m0/s1 |
| InChIKey | RNEPHHFDZBGEPD-NSHDSACASA-N |
| XLogP | 2.35 |
| TPSA | 98.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.21 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|