C13H25NO2S — CID 100650066
4-ethyl-N-[(2R)-2-[(R)-methylsulfinyl]propyl]cyclohexane-1-carboxamide (PubChem CID 100650066) has the molecular formula C13H25NO2S and a molecular weight of 259.41 g/mol. Its IUPAC name is 4-ethyl-N-[(2R)-2-[(R)-methylsulfinyl]propyl]cyclohexane-1-carboxamide.
| Compound Name | 4-ethyl-N-[(2R)-2-[(R)-methylsulfinyl]propyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 100650066 |
| Molecular Formula | C13H25NO2S |
| Molecular Weight | 259.41 g/mol |
| Exact Mass | 259.16 |
| IUPAC Name | 4-ethyl-N-[(2R)-2-[(R)-methylsulfinyl]propyl]cyclohexane-1-carboxamide |
| SMILES | CCC1CCC(C(=O)NC[C@@H](C)[S@@](C)=O)CC1 |
| InChI | InChI=1S/C13H25NO2S/c1-4-11-5-7-12(8-6-11)13(15)14-9-10(2)17(3)16/h10-12H,4-9H2,1-3H3,(H,14,15)/t10-,11?,12?,17-/m1/s1 |
| InChIKey | NSMPLQAZCQPYOW-DLZWWPQDSA-N |
| XLogP | 2.09 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.41 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |