C18H24N4O4S3 — CID 100652350
2-methoxy-5-piperidin-1-ylsulfonyl-N-(5-propan-2-ylsulfanyl-1,3,4-thiadiazol-2-yl)benzamide (PubChem CID 100652350) has the molecular formula C18H24N4O4S3 and a molecular weight of 456.62 g/mol. Its IUPAC name is 2-methoxy-5-piperidin-1-ylsulfonyl-N-(5-propan-2-ylsulfanyl-1,3,4-thiadiazol-2-yl)benzamide.
| Compound Name | 2-methoxy-5-piperidin-1-ylsulfonyl-N-(5-propan-2-ylsulfanyl-1,3,4-thiadiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 100652350 |
| Molecular Formula | C18H24N4O4S3 |
| Molecular Weight | 456.62 g/mol |
| Exact Mass | 456.10 |
| IUPAC Name | 2-methoxy-5-piperidin-1-ylsulfonyl-N-(5-propan-2-ylsulfanyl-1,3,4-thiadiazol-2-yl)benzamide |
| SMILES | COc1ccc(S(=O)(=O)N2CCCCC2)cc1C(=O)Nc1nnc(SC(C)C)s1 |
| InChI | InChI=1S/C18H24N4O4S3/c1-12(2)27-18-21-20-17(28-18)19-16(23)14-11-13(7-8-15(14)26-3)29(24,25)22-9-5-4-6-10-22/h7-8,11-12H,4-6,9-10H2,1-3H3,(H,19,20,23) |
| InChIKey | ZFIHBCAXDTWZNI-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 101.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.62 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|