C21H21NO3 — CID 10065530
2-[5-(3-cyclopentyloxy-4-methoxyphenyl)furan-2-yl]pyridine (PubChem CID 10065530) has the molecular formula C21H21NO3 and a molecular weight of 335.40 g/mol. Its IUPAC name is 2-[5-(3-cyclopentyloxy-4-methoxyphenyl)furan-2-yl]pyridine.
| Compound Name | 2-[5-(3-cyclopentyloxy-4-methoxyphenyl)furan-2-yl]pyridine |
|---|---|
| PubChem CID | 10065530 |
| Molecular Formula | C21H21NO3 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | 2-[5-(3-cyclopentyloxy-4-methoxyphenyl)furan-2-yl]pyridine |
| SMILES | COc1ccc(-c2ccc(-c3ccccn3)o2)cc1OC1CCCC1 |
| InChI | InChI=1S/C21H21NO3/c1-23-20-10-9-15(14-21(20)24-16-6-2-3-7-16)18-11-12-19(25-18)17-8-4-5-13-22-17/h4-5,8-14,16H,2-3,6-7H2,1H3 |
| InChIKey | XWVSZQHLLOXQKA-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 44.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |