C36H36Cl2N4O6S — CID 100658374
(2S)-2-[[2-[N-(benzenesulfonyl)-4-nitroanilino]acetyl]-[(2,6-dichlorophenyl)methyl]amino]-N-cyclohexyl-3-phenylpropanamide (PubChem CID 100658374) has the molecular formula C36H36Cl2N4O6S and a molecular weight of 723.68 g/mol. Its IUPAC name is (2S)-2-[[2-[N-(benzenesulfonyl)-4-nitroanilino]acetyl]-[(2,6-dichlorophenyl)methyl]amino]-N-cyclohexyl-3-phenylpropanamide.
| Compound Name | (2S)-2-[[2-[N-(benzenesulfonyl)-4-nitroanilino]acetyl]-[(2,6-dichlorophenyl)methyl]amino]-N-cyclohexyl-3-phenylpropanamide |
|---|---|
| PubChem CID | 100658374 |
| Molecular Formula | C36H36Cl2N4O6S |
| Molecular Weight | 723.68 g/mol |
| Exact Mass | 722.17 |
| IUPAC Name | (2S)-2-[[2-[N-(benzenesulfonyl)-4-nitroanilino]acetyl]-[(2,6-dichlorophenyl)methyl]amino]-N-cyclohexyl-3-phenylpropanamide |
| SMILES | O=C(NC1CCCCC1)[C@H](Cc1ccccc1)N(Cc1c(Cl)cccc1Cl)C(=O)CN(c1ccc([N+](=O)[O-])cc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C36H36Cl2N4O6S/c37-32-17-10-18-33(38)31(32)24-40(34(23-26-11-4-1-5-12-26)36(44)39-27-13-6-2-7-14-27)35(43)25-41(28-19-21-29(22-20-28)42(45)46)49(47,48)30-15-8-3-9-16-30/h1,3-5,8-12,15-22,27,34H,2,6-7,13-14,23-25H2,(H,39,44)/t34-/m0/s1 |
| InChIKey | BFHHNVWTBQOURA-UMSFTDKQSA-N |
| XLogP | 7.19 |
| TPSA | 129.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 723.68 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|