C36H37ClN4O6S — CID 133176960
2-[[2-[N-(benzenesulfonyl)-4-nitroanilino]acetyl]-[(2-chlorophenyl)methyl]amino]-N-cyclohexyl-3-phenylpropanamide (PubChem CID 133176960) has the molecular formula C36H37ClN4O6S and a molecular weight of 689.23 g/mol. Its IUPAC name is 2-[[2-[N-(benzenesulfonyl)-4-nitroanilino]acetyl]-[(2-chlorophenyl)methyl]amino]-N-cyclohexyl-3-phenylpropanamide.
| Compound Name | 2-[[2-[N-(benzenesulfonyl)-4-nitroanilino]acetyl]-[(2-chlorophenyl)methyl]amino]-N-cyclohexyl-3-phenylpropanamide |
|---|---|
| PubChem CID | 133176960 |
| Molecular Formula | C36H37ClN4O6S |
| Molecular Weight | 689.23 g/mol |
| Exact Mass | 688.21 |
| IUPAC Name | 2-[[2-[N-(benzenesulfonyl)-4-nitroanilino]acetyl]-[(2-chlorophenyl)methyl]amino]-N-cyclohexyl-3-phenylpropanamide |
| SMILES | O=C(NC1CCCCC1)C(Cc1ccccc1)N(Cc1ccccc1Cl)C(=O)CN(c1ccc([N+](=O)[O-])cc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C36H37ClN4O6S/c37-33-19-11-10-14-28(33)25-39(34(24-27-12-4-1-5-13-27)36(43)38-29-15-6-2-7-16-29)35(42)26-40(30-20-22-31(23-21-30)41(44)45)48(46,47)32-17-8-3-9-18-32/h1,3-5,8-14,17-23,29,34H,2,6-7,15-16,24-26H2,(H,38,43) |
| InChIKey | VDRSIRWFFDLBNI-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 129.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.23 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|