C35H34Cl2N4O6S — CID 133250978
2-[[2-[N-(benzenesulfonyl)-3-nitroanilino]acetyl]-[(2,4-dichlorophenyl)methyl]amino]-N-cyclopentyl-3-phenylpropanamide (PubChem CID 133250978) has the molecular formula C35H34Cl2N4O6S and a molecular weight of 709.65 g/mol. Its IUPAC name is 2-[[2-[N-(benzenesulfonyl)-3-nitroanilino]acetyl]-[(2,4-dichlorophenyl)methyl]amino]-N-cyclopentyl-3-phenylpropanamide.
| Compound Name | 2-[[2-[N-(benzenesulfonyl)-3-nitroanilino]acetyl]-[(2,4-dichlorophenyl)methyl]amino]-N-cyclopentyl-3-phenylpropanamide |
|---|---|
| PubChem CID | 133250978 |
| Molecular Formula | C35H34Cl2N4O6S |
| Molecular Weight | 709.65 g/mol |
| Exact Mass | 708.16 |
| IUPAC Name | 2-[[2-[N-(benzenesulfonyl)-3-nitroanilino]acetyl]-[(2,4-dichlorophenyl)methyl]amino]-N-cyclopentyl-3-phenylpropanamide |
| SMILES | O=C(NC1CCCC1)C(Cc1ccccc1)N(Cc1ccc(Cl)cc1Cl)C(=O)CN(c1cccc([N+](=O)[O-])c1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C35H34Cl2N4O6S/c36-27-19-18-26(32(37)21-27)23-39(33(20-25-10-3-1-4-11-25)35(43)38-28-12-7-8-13-28)34(42)24-40(29-14-9-15-30(22-29)41(44)45)48(46,47)31-16-5-2-6-17-31/h1-6,9-11,14-19,21-22,28,33H,7-8,12-13,20,23-24H2,(H,38,43) |
| InChIKey | OGBNWHDSBNBEEJ-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 129.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.65 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|