C36H38N4O6S — CID 125075322
(2R)-2-[[2-[N-(benzenesulfonyl)-3-nitroanilino]acetyl]-benzylamino]-N-cyclohexyl-3-phenylpropanamide (PubChem CID 125075322) has the molecular formula C36H38N4O6S and a molecular weight of 654.79 g/mol. Its IUPAC name is (2R)-2-[[2-[N-(benzenesulfonyl)-3-nitroanilino]acetyl]-benzylamino]-N-cyclohexyl-3-phenylpropanamide.
| Compound Name | (2R)-2-[[2-[N-(benzenesulfonyl)-3-nitroanilino]acetyl]-benzylamino]-N-cyclohexyl-3-phenylpropanamide |
|---|---|
| PubChem CID | 125075322 |
| Molecular Formula | C36H38N4O6S |
| Molecular Weight | 654.79 g/mol |
| Exact Mass | 654.25 |
| IUPAC Name | (2R)-2-[[2-[N-(benzenesulfonyl)-3-nitroanilino]acetyl]-benzylamino]-N-cyclohexyl-3-phenylpropanamide |
| SMILES | O=C(NC1CCCCC1)[C@@H](Cc1ccccc1)N(Cc1ccccc1)C(=O)CN(c1cccc([N+](=O)[O-])c1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C36H38N4O6S/c41-35(27-39(31-20-13-21-32(25-31)40(43)44)47(45,46)33-22-11-4-12-23-33)38(26-29-16-7-2-8-17-29)34(24-28-14-5-1-6-15-28)36(42)37-30-18-9-3-10-19-30/h1-2,4-8,11-17,20-23,25,30,34H,3,9-10,18-19,24,26-27H2,(H,37,42)/t34-/m1/s1 |
| InChIKey | IOWSSFZKMZYZOL-UUWRZZSWSA-N |
| XLogP | 5.88 |
| TPSA | 129.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.79 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|