C20H31N5O3S — CID 100658599
tert-butyl (3aS,6aS)-3a-[2-(4-cyclopropyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)ethylcarbamoyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-2-carboxylate (PubChem CID 100658599) has the molecular formula C20H31N5O3S and a molecular weight of 421.57 g/mol. Its IUPAC name is tert-butyl (3aS,6aS)-3a-[2-(4-cyclopropyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)ethylcarbamoyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-2-carboxylate.
| Compound Name | tert-butyl (3aS,6aS)-3a-[2-(4-cyclopropyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)ethylcarbamoyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 100658599 |
| Molecular Formula | C20H31N5O3S |
| Molecular Weight | 421.57 g/mol |
| Exact Mass | 421.21 |
| IUPAC Name | tert-butyl (3aS,6aS)-3a-[2-(4-cyclopropyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)ethylcarbamoyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@H]2CCC[C@@]2(C(=O)NCCc2n[nH]c(=S)n2C2CC2)C1 |
| InChI | InChI=1S/C20H31N5O3S/c1-19(2,3)28-18(27)24-11-13-5-4-9-20(13,12-24)16(26)21-10-8-15-22-23-17(29)25(15)14-6-7-14/h13-14H,4-12H2,1-3H3,(H,21,26)(H,23,29)/t13-,20-/m1/s1 |
| InChIKey | WOQAKXCPNQNJBS-ZUOKHONESA-N |
| XLogP | 2.97 |
| TPSA | 92.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.57 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|