C13H23BrOZn — CID 10065873
bromozinc(1+);3,3-dimethylbut-1-enoxymethylcyclohexane (PubChem CID 10065873) has the molecular formula C13H23BrOZn and a molecular weight of 340.62 g/mol. Its IUPAC name is bromozinc(1+);3,3-dimethylbut-1-enoxymethylcyclohexane.
| Compound Name | bromozinc(1+);3,3-dimethylbut-1-enoxymethylcyclohexane |
|---|---|
| PubChem CID | 10065873 |
| Molecular Formula | C13H23BrOZn |
| Molecular Weight | 340.62 g/mol |
| Exact Mass | 338.02 |
| IUPAC Name | bromozinc(1+);3,3-dimethylbut-1-enoxymethylcyclohexane |
| SMILES | CC(C)(C)/C=[C-]/OCC1CCCCC1.[Zn+]Br |
| InChI | InChI=1S/C13H23O.BrH.Zn/c1-13(2,3)9-10-14-11-12-7-5-4-6-8-12;;/h9,12H,4-8,11H2,1-3H3;1H;/q-1;;+2/p-1 |
| InChIKey | FSHXDTUWFWMKNS-UHFFFAOYSA-M |
| XLogP | 4.79 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.62 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|