C25H50OSn — CID 11005407
tributyl-[(E)-1-(cyclohexylmethoxy)-3,3-dimethylbut-1-enyl]stannane (PubChem CID 11005407) has the molecular formula C25H50OSn and a molecular weight of 485.39 g/mol. Its IUPAC name is tributyl-[(E)-1-(cyclohexylmethoxy)-3,3-dimethylbut-1-enyl]stannane.
| Compound Name | tributyl-[(E)-1-(cyclohexylmethoxy)-3,3-dimethylbut-1-enyl]stannane |
|---|---|
| PubChem CID | 11005407 |
| Molecular Formula | C25H50OSn |
| Molecular Weight | 485.39 g/mol |
| Exact Mass | 486.29 |
| IUPAC Name | tributyl-[(E)-1-(cyclohexylmethoxy)-3,3-dimethylbut-1-enyl]stannane |
| SMILES | CCCC[Sn](CCCC)(CCCC)/C(=C/C(C)(C)C)OCC1CCCCC1 |
| InChI | InChI=1S/C13H23O.3C4H9.Sn/c1-13(2,3)9-10-14-11-12-7-5-4-6-8-12;3*1-3-4-2;/h9,12H,4-8,11H2,1-3H3;3*1,3-4H2,2H3; |
| InChIKey | OLMNEKISOSIFDS-UHFFFAOYSA-N |
| XLogP | 8.90 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.39 |
| LogP ≤ 5 | 8.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|