C16H20N6O2 — CID 100659329
[(3S)-3-[3-(dimethylamino)pyrazin-2-yl]oxypiperidin-1-yl]-pyrimidin-2-ylmethanone (PubChem CID 100659329) has the molecular formula C16H20N6O2 and a molecular weight of 328.38 g/mol. Its IUPAC name is [(3S)-3-[3-(dimethylamino)pyrazin-2-yl]oxypiperidin-1-yl]-pyrimidin-2-ylmethanone.
| Compound Name | [(3S)-3-[3-(dimethylamino)pyrazin-2-yl]oxypiperidin-1-yl]-pyrimidin-2-ylmethanone |
|---|---|
| PubChem CID | 100659329 |
| Molecular Formula | C16H20N6O2 |
| Molecular Weight | 328.38 g/mol |
| Exact Mass | 328.16 |
| IUPAC Name | [(3S)-3-[3-(dimethylamino)pyrazin-2-yl]oxypiperidin-1-yl]-pyrimidin-2-ylmethanone |
| SMILES | CN(C)c1nccnc1O[C@H]1CCCN(C(=O)c2ncccn2)C1 |
| InChI | InChI=1S/C16H20N6O2/c1-21(2)14-15(20-9-8-19-14)24-12-5-3-10-22(11-12)16(23)13-17-6-4-7-18-13/h4,6-9,12H,3,5,10-11H2,1-2H3/t12-/m0/s1 |
| InChIKey | YNVIAQGDTNZTDK-LBPRGKRZSA-N |
| XLogP | 1.02 |
| TPSA | 84.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.38 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |