C18H14O5S — CID 10065966
dimethyl 4-hydroxy-7-phenyl-1-benzothiophene-5,6-dicarboxylate (PubChem CID 10065966) has the molecular formula C18H14O5S and a molecular weight of 342.37 g/mol. Its IUPAC name is dimethyl 4-hydroxy-7-phenyl-1-benzothiophene-5,6-dicarboxylate.
| Compound Name | dimethyl 4-hydroxy-7-phenyl-1-benzothiophene-5,6-dicarboxylate |
|---|---|
| PubChem CID | 10065966 |
| Molecular Formula | C18H14O5S |
| Molecular Weight | 342.37 g/mol |
| Exact Mass | 342.06 |
| IUPAC Name | dimethyl 4-hydroxy-7-phenyl-1-benzothiophene-5,6-dicarboxylate |
| SMILES | COC(=O)c1c(C(=O)OC)c(-c2ccccc2)c2sccc2c1O |
| InChI | InChI=1S/C18H14O5S/c1-22-17(20)13-12(10-6-4-3-5-7-10)16-11(8-9-24-16)15(19)14(13)18(21)23-2/h3-9,19H,1-2H3 |
| InChIKey | XDVQBPPFTRIQND-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.37 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |