C21H34N4O3 — CID 100662219
tert-butyl N-[(2R)-2-[(4-acetamidopiperidin-1-yl)methyl]-3-pyridin-3-ylpropyl]carbamate (PubChem CID 100662219) has the molecular formula C21H34N4O3 and a molecular weight of 390.53 g/mol. Its IUPAC name is tert-butyl N-[(2R)-2-[(4-acetamidopiperidin-1-yl)methyl]-3-pyridin-3-ylpropyl]carbamate.
| Compound Name | tert-butyl N-[(2R)-2-[(4-acetamidopiperidin-1-yl)methyl]-3-pyridin-3-ylpropyl]carbamate |
|---|---|
| PubChem CID | 100662219 |
| Molecular Formula | C21H34N4O3 |
| Molecular Weight | 390.53 g/mol |
| Exact Mass | 390.26 |
| IUPAC Name | tert-butyl N-[(2R)-2-[(4-acetamidopiperidin-1-yl)methyl]-3-pyridin-3-ylpropyl]carbamate |
| SMILES | CC(=O)NC1CCN(C[C@@H](CNC(=O)OC(C)(C)C)Cc2cccnc2)CC1 |
| InChI | InChI=1S/C21H34N4O3/c1-16(26)24-19-7-10-25(11-8-19)15-18(12-17-6-5-9-22-13-17)14-23-20(27)28-21(2,3)4/h5-6,9,13,18-19H,7-8,10-12,14-15H2,1-4H3,(H,23,27)(H,24,26)/t18-/m1/s1 |
| InChIKey | PLVAQMXKZZLHIY-GOSISDBHSA-N |
| XLogP | 2.37 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.53 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |