C25H33N3O6 — CID 100664759
(2S)-N-[(2R)-butan-2-yl]-2-[[2-(3-methoxy-4-nitrophenoxy)acetyl]-[(2-methylphenyl)methyl]amino]butanamide (PubChem CID 100664759) has the molecular formula C25H33N3O6 and a molecular weight of 471.55 g/mol. Its IUPAC name is (2S)-N-[(2R)-butan-2-yl]-2-[[2-(3-methoxy-4-nitrophenoxy)acetyl]-[(2-methylphenyl)methyl]amino]butanamide.
| Compound Name | (2S)-N-[(2R)-butan-2-yl]-2-[[2-(3-methoxy-4-nitrophenoxy)acetyl]-[(2-methylphenyl)methyl]amino]butanamide |
|---|---|
| PubChem CID | 100664759 |
| Molecular Formula | C25H33N3O6 |
| Molecular Weight | 471.55 g/mol |
| Exact Mass | 471.24 |
| IUPAC Name | (2S)-N-[(2R)-butan-2-yl]-2-[[2-(3-methoxy-4-nitrophenoxy)acetyl]-[(2-methylphenyl)methyl]amino]butanamide |
| SMILES | CC[C@@H](C)NC(=O)[C@H](CC)N(Cc1ccccc1C)C(=O)COc1ccc([N+](=O)[O-])c(OC)c1 |
| InChI | InChI=1S/C25H33N3O6/c1-6-18(4)26-25(30)21(7-2)27(15-19-11-9-8-10-17(19)3)24(29)16-34-20-12-13-22(28(31)32)23(14-20)33-5/h8-14,18,21H,6-7,15-16H2,1-5H3,(H,26,30)/t18-,21+/m1/s1 |
| InChIKey | CBCXWQNTHNVVDP-NQIIRXRSSA-N |
| XLogP | 4.01 |
| TPSA | 111.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.55 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|