C24H29Cl2N3O6 — CID 100741762
(2S)-N-[(2S)-butan-2-yl]-2-[(2,6-dichlorophenyl)methyl-[2-(3-methoxy-4-nitrophenoxy)acetyl]amino]butanamide (PubChem CID 100741762) has the molecular formula C24H29Cl2N3O6 and a molecular weight of 526.42 g/mol. Its IUPAC name is (2S)-N-[(2S)-butan-2-yl]-2-[(2,6-dichlorophenyl)methyl-[2-(3-methoxy-4-nitrophenoxy)acetyl]amino]butanamide.
| Compound Name | (2S)-N-[(2S)-butan-2-yl]-2-[(2,6-dichlorophenyl)methyl-[2-(3-methoxy-4-nitrophenoxy)acetyl]amino]butanamide |
|---|---|
| PubChem CID | 100741762 |
| Molecular Formula | C24H29Cl2N3O6 |
| Molecular Weight | 526.42 g/mol |
| Exact Mass | 525.14 |
| IUPAC Name | (2S)-N-[(2S)-butan-2-yl]-2-[(2,6-dichlorophenyl)methyl-[2-(3-methoxy-4-nitrophenoxy)acetyl]amino]butanamide |
| SMILES | CC[C@H](C)NC(=O)[C@H](CC)N(Cc1c(Cl)cccc1Cl)C(=O)COc1ccc([N+](=O)[O-])c(OC)c1 |
| InChI | InChI=1S/C24H29Cl2N3O6/c1-5-15(3)27-24(31)20(6-2)28(13-17-18(25)8-7-9-19(17)26)23(30)14-35-16-10-11-21(29(32)33)22(12-16)34-4/h7-12,15,20H,5-6,13-14H2,1-4H3,(H,27,31)/t15-,20-/m0/s1 |
| InChIKey | RQYIFKSFUHDRIB-YWZLYKJASA-N |
| XLogP | 5.01 |
| TPSA | 111.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.42 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|