C21H23Cl2N3O6 — CID 132677589
2-[(2,6-dichlorophenyl)methyl-[2-(3-methoxy-4-nitrophenoxy)acetyl]amino]-N-ethylpropanamide (PubChem CID 132677589) has the molecular formula C21H23Cl2N3O6 and a molecular weight of 484.34 g/mol. Its IUPAC name is 2-[(2,6-dichlorophenyl)methyl-[2-(3-methoxy-4-nitrophenoxy)acetyl]amino]-N-ethylpropanamide.
| Compound Name | 2-[(2,6-dichlorophenyl)methyl-[2-(3-methoxy-4-nitrophenoxy)acetyl]amino]-N-ethylpropanamide |
|---|---|
| PubChem CID | 132677589 |
| Molecular Formula | C21H23Cl2N3O6 |
| Molecular Weight | 484.34 g/mol |
| Exact Mass | 483.10 |
| IUPAC Name | 2-[(2,6-dichlorophenyl)methyl-[2-(3-methoxy-4-nitrophenoxy)acetyl]amino]-N-ethylpropanamide |
| SMILES | CCNC(=O)C(C)N(Cc1c(Cl)cccc1Cl)C(=O)COc1ccc([N+](=O)[O-])c(OC)c1 |
| InChI | InChI=1S/C21H23Cl2N3O6/c1-4-24-21(28)13(2)25(11-15-16(22)6-5-7-17(15)23)20(27)12-32-14-8-9-18(26(29)30)19(10-14)31-3/h5-10,13H,4,11-12H2,1-3H3,(H,24,28) |
| InChIKey | KSRVKOOASCFDQL-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 111.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.34 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|