C22H25Cl2N3O6 — CID 132679737
2-[(2,4-dichlorophenyl)methyl-[2-(3-methoxy-4-nitrophenoxy)acetyl]amino]-N-propan-2-ylpropanamide (PubChem CID 132679737) has the molecular formula C22H25Cl2N3O6 and a molecular weight of 498.36 g/mol. Its IUPAC name is 2-[(2,4-dichlorophenyl)methyl-[2-(3-methoxy-4-nitrophenoxy)acetyl]amino]-N-propan-2-ylpropanamide.
| Compound Name | 2-[(2,4-dichlorophenyl)methyl-[2-(3-methoxy-4-nitrophenoxy)acetyl]amino]-N-propan-2-ylpropanamide |
|---|---|
| PubChem CID | 132679737 |
| Molecular Formula | C22H25Cl2N3O6 |
| Molecular Weight | 498.36 g/mol |
| Exact Mass | 497.11 |
| IUPAC Name | 2-[(2,4-dichlorophenyl)methyl-[2-(3-methoxy-4-nitrophenoxy)acetyl]amino]-N-propan-2-ylpropanamide |
| SMILES | COc1cc(OCC(=O)N(Cc2ccc(Cl)cc2Cl)C(C)C(=O)NC(C)C)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H25Cl2N3O6/c1-13(2)25-22(29)14(3)26(11-15-5-6-16(23)9-18(15)24)21(28)12-33-17-7-8-19(27(30)31)20(10-17)32-4/h5-10,13-14H,11-12H2,1-4H3,(H,25,29) |
| InChIKey | XZADLVJSUQFTTF-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 111.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.36 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|