C23H29N3O6 — CID 100726089
(2R)-2-[[2-(3-methoxy-4-nitrophenoxy)acetyl]-(2-phenylethyl)amino]-N-propan-2-ylpropanamide (PubChem CID 100726089) has the molecular formula C23H29N3O6 and a molecular weight of 443.50 g/mol. Its IUPAC name is (2R)-2-[[2-(3-methoxy-4-nitrophenoxy)acetyl]-(2-phenylethyl)amino]-N-propan-2-ylpropanamide.
| Compound Name | (2R)-2-[[2-(3-methoxy-4-nitrophenoxy)acetyl]-(2-phenylethyl)amino]-N-propan-2-ylpropanamide |
|---|---|
| PubChem CID | 100726089 |
| Molecular Formula | C23H29N3O6 |
| Molecular Weight | 443.50 g/mol |
| Exact Mass | 443.21 |
| IUPAC Name | (2R)-2-[[2-(3-methoxy-4-nitrophenoxy)acetyl]-(2-phenylethyl)amino]-N-propan-2-ylpropanamide |
| SMILES | COc1cc(OCC(=O)N(CCc2ccccc2)[C@H](C)C(=O)NC(C)C)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C23H29N3O6/c1-16(2)24-23(28)17(3)25(13-12-18-8-6-5-7-9-18)22(27)15-32-19-10-11-20(26(29)30)21(14-19)31-4/h5-11,14,16-17H,12-13,15H2,1-4H3,(H,24,28)/t17-/m1/s1 |
| InChIKey | BIZWQQDSYNGQBW-QGZVFWFLSA-N |
| XLogP | 2.97 |
| TPSA | 111.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.50 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|