C29H33N3O7 — CID 100550118
(2S)-2-[[2-(3-methoxy-4-nitrophenoxy)acetyl]-[(3-methoxyphenyl)methyl]amino]-3-phenyl-N-propan-2-ylpropanamide (PubChem CID 100550118) has the molecular formula C29H33N3O7 and a molecular weight of 535.60 g/mol. Its IUPAC name is (2S)-2-[[2-(3-methoxy-4-nitrophenoxy)acetyl]-[(3-methoxyphenyl)methyl]amino]-3-phenyl-N-propan-2-ylpropanamide.
| Compound Name | (2S)-2-[[2-(3-methoxy-4-nitrophenoxy)acetyl]-[(3-methoxyphenyl)methyl]amino]-3-phenyl-N-propan-2-ylpropanamide |
|---|---|
| PubChem CID | 100550118 |
| Molecular Formula | C29H33N3O7 |
| Molecular Weight | 535.60 g/mol |
| Exact Mass | 535.23 |
| IUPAC Name | (2S)-2-[[2-(3-methoxy-4-nitrophenoxy)acetyl]-[(3-methoxyphenyl)methyl]amino]-3-phenyl-N-propan-2-ylpropanamide |
| SMILES | COc1cccc(CN(C(=O)COc2ccc([N+](=O)[O-])c(OC)c2)[C@@H](Cc2ccccc2)C(=O)NC(C)C)c1 |
| InChI | InChI=1S/C29H33N3O7/c1-20(2)30-29(34)26(16-21-9-6-5-7-10-21)31(18-22-11-8-12-23(15-22)37-3)28(33)19-39-24-13-14-25(32(35)36)27(17-24)38-4/h5-15,17,20,26H,16,18-19H2,1-4H3,(H,30,34)/t26-/m0/s1 |
| InChIKey | BIKBSXITZCDKBC-SANMLTNESA-N |
| XLogP | 4.16 |
| TPSA | 120.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.60 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|