C30H32BrN3O6 — CID 100522687
(2R)-2-[(3-bromophenyl)methyl-[2-(3-methoxy-4-nitrophenoxy)acetyl]amino]-N-cyclopentyl-3-phenylpropanamide (PubChem CID 100522687) has the molecular formula C30H32BrN3O6 and a molecular weight of 610.51 g/mol. Its IUPAC name is (2R)-2-[(3-bromophenyl)methyl-[2-(3-methoxy-4-nitrophenoxy)acetyl]amino]-N-cyclopentyl-3-phenylpropanamide.
| Compound Name | (2R)-2-[(3-bromophenyl)methyl-[2-(3-methoxy-4-nitrophenoxy)acetyl]amino]-N-cyclopentyl-3-phenylpropanamide |
|---|---|
| PubChem CID | 100522687 |
| Molecular Formula | C30H32BrN3O6 |
| Molecular Weight | 610.51 g/mol |
| Exact Mass | 609.15 |
| IUPAC Name | (2R)-2-[(3-bromophenyl)methyl-[2-(3-methoxy-4-nitrophenoxy)acetyl]amino]-N-cyclopentyl-3-phenylpropanamide |
| SMILES | COc1cc(OCC(=O)N(Cc2cccc(Br)c2)[C@H](Cc2ccccc2)C(=O)NC2CCCC2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C30H32BrN3O6/c1-39-28-18-25(14-15-26(28)34(37)38)40-20-29(35)33(19-22-10-7-11-23(31)16-22)27(17-21-8-3-2-4-9-21)30(36)32-24-12-5-6-13-24/h2-4,7-11,14-16,18,24,27H,5-6,12-13,17,19-20H2,1H3,(H,32,36)/t27-/m1/s1 |
| InChIKey | GDBTVZJGYMGFKQ-HHHXNRCGSA-N |
| XLogP | 5.44 |
| TPSA | 111.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.51 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|