C31H34FN3O6 — CID 100611202
(2R)-N-cyclohexyl-2-[(2-fluorophenyl)methyl-[2-(3-methoxy-4-nitrophenoxy)acetyl]amino]-3-phenylpropanamide (PubChem CID 100611202) has the molecular formula C31H34FN3O6 and a molecular weight of 563.63 g/mol. Its IUPAC name is (2R)-N-cyclohexyl-2-[(2-fluorophenyl)methyl-[2-(3-methoxy-4-nitrophenoxy)acetyl]amino]-3-phenylpropanamide.
| Compound Name | (2R)-N-cyclohexyl-2-[(2-fluorophenyl)methyl-[2-(3-methoxy-4-nitrophenoxy)acetyl]amino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 100611202 |
| Molecular Formula | C31H34FN3O6 |
| Molecular Weight | 563.63 g/mol |
| Exact Mass | 563.24 |
| IUPAC Name | (2R)-N-cyclohexyl-2-[(2-fluorophenyl)methyl-[2-(3-methoxy-4-nitrophenoxy)acetyl]amino]-3-phenylpropanamide |
| SMILES | COc1cc(OCC(=O)N(Cc2ccccc2F)[C@H](Cc2ccccc2)C(=O)NC2CCCCC2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C31H34FN3O6/c1-40-29-19-25(16-17-27(29)35(38)39)41-21-30(36)34(20-23-12-8-9-15-26(23)32)28(18-22-10-4-2-5-11-22)31(37)33-24-13-6-3-7-14-24/h2,4-5,8-12,15-17,19,24,28H,3,6-7,13-14,18,20-21H2,1H3,(H,33,37)/t28-/m1/s1 |
| InChIKey | VWQWMNNVHYSXEG-MUUNZHRXSA-N |
| XLogP | 5.21 |
| TPSA | 111.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.63 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|