C27H27Cl2N3O6 — CID 132628617
2-[(2,4-dichlorophenyl)methyl-[2-(3-methoxy-4-nitrophenoxy)acetyl]amino]-N-ethyl-3-phenylpropanamide (PubChem CID 132628617) has the molecular formula C27H27Cl2N3O6 and a molecular weight of 560.43 g/mol. Its IUPAC name is 2-[(2,4-dichlorophenyl)methyl-[2-(3-methoxy-4-nitrophenoxy)acetyl]amino]-N-ethyl-3-phenylpropanamide.
| Compound Name | 2-[(2,4-dichlorophenyl)methyl-[2-(3-methoxy-4-nitrophenoxy)acetyl]amino]-N-ethyl-3-phenylpropanamide |
|---|---|
| PubChem CID | 132628617 |
| Molecular Formula | C27H27Cl2N3O6 |
| Molecular Weight | 560.43 g/mol |
| Exact Mass | 559.13 |
| IUPAC Name | 2-[(2,4-dichlorophenyl)methyl-[2-(3-methoxy-4-nitrophenoxy)acetyl]amino]-N-ethyl-3-phenylpropanamide |
| SMILES | CCNC(=O)C(Cc1ccccc1)N(Cc1ccc(Cl)cc1Cl)C(=O)COc1ccc([N+](=O)[O-])c(OC)c1 |
| InChI | InChI=1S/C27H27Cl2N3O6/c1-3-30-27(34)24(13-18-7-5-4-6-8-18)31(16-19-9-10-20(28)14-22(19)29)26(33)17-38-21-11-12-23(32(35)36)25(15-21)37-2/h4-12,14-15,24H,3,13,16-17H2,1-2H3,(H,30,34) |
| InChIKey | SSPQVKACSVQSBD-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 111.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.43 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|