C23H27Cl2N3O6 — CID 100588955
(2S)-2-[(2,4-dichlorophenyl)methyl-[2-(3-methoxy-4-nitrophenoxy)acetyl]amino]-N-propylbutanamide (PubChem CID 100588955) has the molecular formula C23H27Cl2N3O6 and a molecular weight of 512.39 g/mol. Its IUPAC name is (2S)-2-[(2,4-dichlorophenyl)methyl-[2-(3-methoxy-4-nitrophenoxy)acetyl]amino]-N-propylbutanamide.
| Compound Name | (2S)-2-[(2,4-dichlorophenyl)methyl-[2-(3-methoxy-4-nitrophenoxy)acetyl]amino]-N-propylbutanamide |
|---|---|
| PubChem CID | 100588955 |
| Molecular Formula | C23H27Cl2N3O6 |
| Molecular Weight | 512.39 g/mol |
| Exact Mass | 511.13 |
| IUPAC Name | (2S)-2-[(2,4-dichlorophenyl)methyl-[2-(3-methoxy-4-nitrophenoxy)acetyl]amino]-N-propylbutanamide |
| SMILES | CCCNC(=O)[C@H](CC)N(Cc1ccc(Cl)cc1Cl)C(=O)COc1ccc([N+](=O)[O-])c(OC)c1 |
| InChI | InChI=1S/C23H27Cl2N3O6/c1-4-10-26-23(30)19(5-2)27(13-15-6-7-16(24)11-18(15)25)22(29)14-34-17-8-9-20(28(31)32)21(12-17)33-3/h6-9,11-12,19H,4-5,10,13-14H2,1-3H3,(H,26,30)/t19-/m0/s1 |
| InChIKey | QWUDEEKTAMKCGS-IBGZPJMESA-N |
| XLogP | 4.62 |
| TPSA | 111.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.39 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|