C24H30ClN3O6 — CID 132945108
2-[(4-chlorophenyl)methyl-[2-(3-methoxy-4-nitrophenoxy)acetyl]amino]-N-(2-methylpropyl)butanamide (PubChem CID 132945108) has the molecular formula C24H30ClN3O6 and a molecular weight of 491.97 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)methyl-[2-(3-methoxy-4-nitrophenoxy)acetyl]amino]-N-(2-methylpropyl)butanamide.
| Compound Name | 2-[(4-chlorophenyl)methyl-[2-(3-methoxy-4-nitrophenoxy)acetyl]amino]-N-(2-methylpropyl)butanamide |
|---|---|
| PubChem CID | 132945108 |
| Molecular Formula | C24H30ClN3O6 |
| Molecular Weight | 491.97 g/mol |
| Exact Mass | 491.18 |
| IUPAC Name | 2-[(4-chlorophenyl)methyl-[2-(3-methoxy-4-nitrophenoxy)acetyl]amino]-N-(2-methylpropyl)butanamide |
| SMILES | CCC(C(=O)NCC(C)C)N(Cc1ccc(Cl)cc1)C(=O)COc1ccc([N+](=O)[O-])c(OC)c1 |
| InChI | InChI=1S/C24H30ClN3O6/c1-5-20(24(30)26-13-16(2)3)27(14-17-6-8-18(25)9-7-17)23(29)15-34-19-10-11-21(28(31)32)22(12-19)33-4/h6-12,16,20H,5,13-15H2,1-4H3,(H,26,30) |
| InChIKey | ZQWHMPXIAALUGB-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 111.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.97 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|