C25H30ClN3O6 — CID 132619894
2-[(4-chlorophenyl)methyl-[2-(3-methoxy-4-nitrophenoxy)acetyl]amino]-N-cyclopentylbutanamide (PubChem CID 132619894) has the molecular formula C25H30ClN3O6 and a molecular weight of 503.98 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)methyl-[2-(3-methoxy-4-nitrophenoxy)acetyl]amino]-N-cyclopentylbutanamide.
| Compound Name | 2-[(4-chlorophenyl)methyl-[2-(3-methoxy-4-nitrophenoxy)acetyl]amino]-N-cyclopentylbutanamide |
|---|---|
| PubChem CID | 132619894 |
| Molecular Formula | C25H30ClN3O6 |
| Molecular Weight | 503.98 g/mol |
| Exact Mass | 503.18 |
| IUPAC Name | 2-[(4-chlorophenyl)methyl-[2-(3-methoxy-4-nitrophenoxy)acetyl]amino]-N-cyclopentylbutanamide |
| SMILES | CCC(C(=O)NC1CCCC1)N(Cc1ccc(Cl)cc1)C(=O)COc1ccc([N+](=O)[O-])c(OC)c1 |
| InChI | InChI=1S/C25H30ClN3O6/c1-3-21(25(31)27-19-6-4-5-7-19)28(15-17-8-10-18(26)11-9-17)24(30)16-35-20-12-13-22(29(32)33)23(14-20)34-2/h8-14,19,21H,3-7,15-16H2,1-2H3,(H,27,31) |
| InChIKey | MLZZXFLSNRMZQB-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 111.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.98 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|