C25H31N3O7 — CID 132617484
N-cyclopentyl-2-[[2-(3-methoxy-4-nitrophenoxy)acetyl]-[(4-methoxyphenyl)methyl]amino]propanamide (PubChem CID 132617484) has the molecular formula C25H31N3O7 and a molecular weight of 485.54 g/mol. Its IUPAC name is N-cyclopentyl-2-[[2-(3-methoxy-4-nitrophenoxy)acetyl]-[(4-methoxyphenyl)methyl]amino]propanamide.
| Compound Name | N-cyclopentyl-2-[[2-(3-methoxy-4-nitrophenoxy)acetyl]-[(4-methoxyphenyl)methyl]amino]propanamide |
|---|---|
| PubChem CID | 132617484 |
| Molecular Formula | C25H31N3O7 |
| Molecular Weight | 485.54 g/mol |
| Exact Mass | 485.22 |
| IUPAC Name | N-cyclopentyl-2-[[2-(3-methoxy-4-nitrophenoxy)acetyl]-[(4-methoxyphenyl)methyl]amino]propanamide |
| SMILES | COc1ccc(CN(C(=O)COc2ccc([N+](=O)[O-])c(OC)c2)C(C)C(=O)NC2CCCC2)cc1 |
| InChI | InChI=1S/C25H31N3O7/c1-17(25(30)26-19-6-4-5-7-19)27(15-18-8-10-20(33-2)11-9-18)24(29)16-35-21-12-13-22(28(31)32)23(14-21)34-3/h8-14,17,19H,4-7,15-16H2,1-3H3,(H,26,30) |
| InChIKey | PBRZFOJJRIVXOI-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 120.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.54 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|