C20H22FN3O6 — CID 132666032
2-[(4-fluorophenyl)methyl-[2-(3-methoxy-4-nitrophenoxy)acetyl]amino]-N-methylpropanamide (PubChem CID 132666032) has the molecular formula C20H22FN3O6 and a molecular weight of 419.41 g/mol. Its IUPAC name is 2-[(4-fluorophenyl)methyl-[2-(3-methoxy-4-nitrophenoxy)acetyl]amino]-N-methylpropanamide.
| Compound Name | 2-[(4-fluorophenyl)methyl-[2-(3-methoxy-4-nitrophenoxy)acetyl]amino]-N-methylpropanamide |
|---|---|
| PubChem CID | 132666032 |
| Molecular Formula | C20H22FN3O6 |
| Molecular Weight | 419.41 g/mol |
| Exact Mass | 419.15 |
| IUPAC Name | 2-[(4-fluorophenyl)methyl-[2-(3-methoxy-4-nitrophenoxy)acetyl]amino]-N-methylpropanamide |
| SMILES | CNC(=O)C(C)N(Cc1ccc(F)cc1)C(=O)COc1ccc([N+](=O)[O-])c(OC)c1 |
| InChI | InChI=1S/C20H22FN3O6/c1-13(20(26)22-2)23(11-14-4-6-15(21)7-5-14)19(25)12-30-16-8-9-17(24(27)28)18(10-16)29-3/h4-10,13H,11-12H2,1-3H3,(H,22,26) |
| InChIKey | CYHYQSYHRPGHNQ-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 111.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.41 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|