C22H26ClN3O6 — CID 133201455
2-[(3-chlorophenyl)methyl-[2-(3-methoxy-4-nitrophenoxy)acetyl]amino]-N-propan-2-ylpropanamide (PubChem CID 133201455) has the molecular formula C22H26ClN3O6 and a molecular weight of 463.92 g/mol. Its IUPAC name is 2-[(3-chlorophenyl)methyl-[2-(3-methoxy-4-nitrophenoxy)acetyl]amino]-N-propan-2-ylpropanamide.
| Compound Name | 2-[(3-chlorophenyl)methyl-[2-(3-methoxy-4-nitrophenoxy)acetyl]amino]-N-propan-2-ylpropanamide |
|---|---|
| PubChem CID | 133201455 |
| Molecular Formula | C22H26ClN3O6 |
| Molecular Weight | 463.92 g/mol |
| Exact Mass | 463.15 |
| IUPAC Name | 2-[(3-chlorophenyl)methyl-[2-(3-methoxy-4-nitrophenoxy)acetyl]amino]-N-propan-2-ylpropanamide |
| SMILES | COc1cc(OCC(=O)N(Cc2cccc(Cl)c2)C(C)C(=O)NC(C)C)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H26ClN3O6/c1-14(2)24-22(28)15(3)25(12-16-6-5-7-17(23)10-16)21(27)13-32-18-8-9-19(26(29)30)20(11-18)31-4/h5-11,14-15H,12-13H2,1-4H3,(H,24,28) |
| InChIKey | SIYRDJALISVKRI-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 111.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.92 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|