C23H29N3O7 — CID 100522114
(2S)-2-[[2-(3-methoxy-4-nitrophenoxy)acetyl]-[(3-methoxyphenyl)methyl]amino]-N-propylpropanamide (PubChem CID 100522114) has the molecular formula C23H29N3O7 and a molecular weight of 459.50 g/mol. Its IUPAC name is (2S)-2-[[2-(3-methoxy-4-nitrophenoxy)acetyl]-[(3-methoxyphenyl)methyl]amino]-N-propylpropanamide.
| Compound Name | (2S)-2-[[2-(3-methoxy-4-nitrophenoxy)acetyl]-[(3-methoxyphenyl)methyl]amino]-N-propylpropanamide |
|---|---|
| PubChem CID | 100522114 |
| Molecular Formula | C23H29N3O7 |
| Molecular Weight | 459.50 g/mol |
| Exact Mass | 459.20 |
| IUPAC Name | (2S)-2-[[2-(3-methoxy-4-nitrophenoxy)acetyl]-[(3-methoxyphenyl)methyl]amino]-N-propylpropanamide |
| SMILES | CCCNC(=O)[C@H](C)N(Cc1cccc(OC)c1)C(=O)COc1ccc([N+](=O)[O-])c(OC)c1 |
| InChI | InChI=1S/C23H29N3O7/c1-5-11-24-23(28)16(2)25(14-17-7-6-8-18(12-17)31-3)22(27)15-33-19-9-10-20(26(29)30)21(13-19)32-4/h6-10,12-13,16H,5,11,14-15H2,1-4H3,(H,24,28)/t16-/m0/s1 |
| InChIKey | UITMHQDVIJVMRW-INIZCTEOSA-N |
| XLogP | 2.93 |
| TPSA | 120.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.50 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|