C28H31N3O6 — CID 133195398
2-[benzyl-[2-(3-methoxy-4-nitrophenoxy)acetyl]amino]-3-phenyl-N-propan-2-ylpropanamide (PubChem CID 133195398) has the molecular formula C28H31N3O6 and a molecular weight of 505.57 g/mol. Its IUPAC name is 2-[benzyl-[2-(3-methoxy-4-nitrophenoxy)acetyl]amino]-3-phenyl-N-propan-2-ylpropanamide.
| Compound Name | 2-[benzyl-[2-(3-methoxy-4-nitrophenoxy)acetyl]amino]-3-phenyl-N-propan-2-ylpropanamide |
|---|---|
| PubChem CID | 133195398 |
| Molecular Formula | C28H31N3O6 |
| Molecular Weight | 505.57 g/mol |
| Exact Mass | 505.22 |
| IUPAC Name | 2-[benzyl-[2-(3-methoxy-4-nitrophenoxy)acetyl]amino]-3-phenyl-N-propan-2-ylpropanamide |
| SMILES | COc1cc(OCC(=O)N(Cc2ccccc2)C(Cc2ccccc2)C(=O)NC(C)C)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C28H31N3O6/c1-20(2)29-28(33)25(16-21-10-6-4-7-11-21)30(18-22-12-8-5-9-13-22)27(32)19-37-23-14-15-24(31(34)35)26(17-23)36-3/h4-15,17,20,25H,16,18-19H2,1-3H3,(H,29,33) |
| InChIKey | OHBINOQJUAVTMC-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 111.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.57 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|