C30H32FN3O6 — CID 100512960
(2R)-N-cyclopentyl-2-[(2-fluorophenyl)methyl-[2-(3-methoxy-4-nitrophenoxy)acetyl]amino]-3-phenylpropanamide (PubChem CID 100512960) has the molecular formula C30H32FN3O6 and a molecular weight of 549.60 g/mol. Its IUPAC name is (2R)-N-cyclopentyl-2-[(2-fluorophenyl)methyl-[2-(3-methoxy-4-nitrophenoxy)acetyl]amino]-3-phenylpropanamide.
| Compound Name | (2R)-N-cyclopentyl-2-[(2-fluorophenyl)methyl-[2-(3-methoxy-4-nitrophenoxy)acetyl]amino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 100512960 |
| Molecular Formula | C30H32FN3O6 |
| Molecular Weight | 549.60 g/mol |
| Exact Mass | 549.23 |
| IUPAC Name | (2R)-N-cyclopentyl-2-[(2-fluorophenyl)methyl-[2-(3-methoxy-4-nitrophenoxy)acetyl]amino]-3-phenylpropanamide |
| SMILES | COc1cc(OCC(=O)N(Cc2ccccc2F)[C@H](Cc2ccccc2)C(=O)NC2CCCC2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C30H32FN3O6/c1-39-28-18-24(15-16-26(28)34(37)38)40-20-29(35)33(19-22-11-5-8-14-25(22)31)27(17-21-9-3-2-4-10-21)30(36)32-23-12-6-7-13-23/h2-5,8-11,14-16,18,23,27H,6-7,12-13,17,19-20H2,1H3,(H,32,36)/t27-/m1/s1 |
| InChIKey | WMNLBKGWUOKYEF-HHHXNRCGSA-N |
| XLogP | 4.82 |
| TPSA | 111.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.60 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|