C29H32BrN3O6 — CID 100679224
(2R)-2-[(4-bromophenyl)methyl-[2-(3-methoxy-4-nitrophenoxy)acetyl]amino]-N-butyl-3-phenylpropanamide (PubChem CID 100679224) has the molecular formula C29H32BrN3O6 and a molecular weight of 598.49 g/mol. Its IUPAC name is (2R)-2-[(4-bromophenyl)methyl-[2-(3-methoxy-4-nitrophenoxy)acetyl]amino]-N-butyl-3-phenylpropanamide.
| Compound Name | (2R)-2-[(4-bromophenyl)methyl-[2-(3-methoxy-4-nitrophenoxy)acetyl]amino]-N-butyl-3-phenylpropanamide |
|---|---|
| PubChem CID | 100679224 |
| Molecular Formula | C29H32BrN3O6 |
| Molecular Weight | 598.49 g/mol |
| Exact Mass | 597.15 |
| IUPAC Name | (2R)-2-[(4-bromophenyl)methyl-[2-(3-methoxy-4-nitrophenoxy)acetyl]amino]-N-butyl-3-phenylpropanamide |
| SMILES | CCCCNC(=O)[C@@H](Cc1ccccc1)N(Cc1ccc(Br)cc1)C(=O)COc1ccc([N+](=O)[O-])c(OC)c1 |
| InChI | InChI=1S/C29H32BrN3O6/c1-3-4-16-31-29(35)26(17-21-8-6-5-7-9-21)32(19-22-10-12-23(30)13-11-22)28(34)20-39-24-14-15-25(33(36)37)27(18-24)38-2/h5-15,18,26H,3-4,16-17,19-20H2,1-2H3,(H,31,35)/t26-/m1/s1 |
| InChIKey | ZFHMKAISMODFQC-AREMUKBSSA-N |
| XLogP | 5.30 |
| TPSA | 111.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.49 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|