C29H31Cl2N3O6 — CID 133207287
N-butyl-2-[(3,4-dichlorophenyl)methyl-[2-(3-methoxy-4-nitrophenoxy)acetyl]amino]-3-phenylpropanamide (PubChem CID 133207287) has the molecular formula C29H31Cl2N3O6 and a molecular weight of 588.49 g/mol. Its IUPAC name is N-butyl-2-[(3,4-dichlorophenyl)methyl-[2-(3-methoxy-4-nitrophenoxy)acetyl]amino]-3-phenylpropanamide.
| Compound Name | N-butyl-2-[(3,4-dichlorophenyl)methyl-[2-(3-methoxy-4-nitrophenoxy)acetyl]amino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 133207287 |
| Molecular Formula | C29H31Cl2N3O6 |
| Molecular Weight | 588.49 g/mol |
| Exact Mass | 587.16 |
| IUPAC Name | N-butyl-2-[(3,4-dichlorophenyl)methyl-[2-(3-methoxy-4-nitrophenoxy)acetyl]amino]-3-phenylpropanamide |
| SMILES | CCCCNC(=O)C(Cc1ccccc1)N(Cc1ccc(Cl)c(Cl)c1)C(=O)COc1ccc([N+](=O)[O-])c(OC)c1 |
| InChI | InChI=1S/C29H31Cl2N3O6/c1-3-4-14-32-29(36)26(16-20-8-6-5-7-9-20)33(18-21-10-12-23(30)24(31)15-21)28(35)19-40-22-11-13-25(34(37)38)27(17-22)39-2/h5-13,15,17,26H,3-4,14,16,18-19H2,1-2H3,(H,32,36) |
| InChIKey | SKQCQRFELGNHFO-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 111.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.49 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|