C17H22O6S — CID 10066716
dimethyl (2R)-2-(1-hydroxypropyl)-2-[(S)-(4-methylphenyl)sulfinyl]cyclopropane-1,1-dicarboxylate (PubChem CID 10066716) has the molecular formula C17H22O6S and a molecular weight of 354.42 g/mol. Its IUPAC name is dimethyl (2R)-2-(1-hydroxypropyl)-2-[(S)-(4-methylphenyl)sulfinyl]cyclopropane-1,1-dicarboxylate.
| Compound Name | dimethyl (2R)-2-(1-hydroxypropyl)-2-[(S)-(4-methylphenyl)sulfinyl]cyclopropane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 10066716 |
| Molecular Formula | C17H22O6S |
| Molecular Weight | 354.42 g/mol |
| Exact Mass | 354.11 |
| IUPAC Name | dimethyl (2R)-2-(1-hydroxypropyl)-2-[(S)-(4-methylphenyl)sulfinyl]cyclopropane-1,1-dicarboxylate |
| SMILES | CCC(O)[C@@]1([S@@](=O)c2ccc(C)cc2)CC1(C(=O)OC)C(=O)OC |
| InChI | InChI=1S/C17H22O6S/c1-5-13(18)17(24(21)12-8-6-11(2)7-9-12)10-16(17,14(19)22-3)15(20)23-4/h6-9,13,18H,5,10H2,1-4H3/t13?,17-,24-/m0/s1 |
| InChIKey | ZVEASVTYRBQRSZ-CFMHPDKWSA-N |
| XLogP | 1.35 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.42 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|