C31H52O4S — CID 54521825
(2R,3R)-4-tert-butyl-3-hydroxy-2-[(R)-(4-methylphenyl)sulfinyl]icos-11-enoic acid (PubChem CID 54521825) has the molecular formula C31H52O4S and a molecular weight of 520.82 g/mol. Its IUPAC name is (2R,3R)-4-tert-butyl-3-hydroxy-2-[(R)-(4-methylphenyl)sulfinyl]icos-11-enoic acid.
| Compound Name | (2R,3R)-4-tert-butyl-3-hydroxy-2-[(R)-(4-methylphenyl)sulfinyl]icos-11-enoic acid |
|---|---|
| PubChem CID | 54521825 |
| Molecular Formula | C31H52O4S |
| Molecular Weight | 520.82 g/mol |
| Exact Mass | 520.36 |
| IUPAC Name | (2R,3R)-4-tert-butyl-3-hydroxy-2-[(R)-(4-methylphenyl)sulfinyl]icos-11-enoic acid |
| SMILES | CCCCCCCCC=CCCCCCCC([C@@H](O)[C@H](C(=O)O)[S@@](=O)c1ccc(C)cc1)C(C)(C)C |
| InChI | InChI=1S/C31H52O4S/c1-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-27(31(3,4)5)28(32)29(30(33)34)36(35)26-23-21-25(2)22-24-26/h13-14,21-24,27-29,32H,6-12,15-20H2,1-5H3,(H,33,34)/t27?,28-,29-,36+/m1/s1 |
| InChIKey | YQIQHKPHIFCXQA-MFXLDLAOSA-N |
| XLogP | 8.23 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.82 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|