C19H30O3S — CID 134918831
tert-butyl (2R,3R)-3-hydroxy-2-(phenylsulfanylmethyl)octanoate (PubChem CID 134918831) has the molecular formula C19H30O3S and a molecular weight of 338.51 g/mol. Its IUPAC name is tert-butyl (2R,3R)-3-hydroxy-2-(phenylsulfanylmethyl)octanoate.
| Compound Name | tert-butyl (2R,3R)-3-hydroxy-2-(phenylsulfanylmethyl)octanoate |
|---|---|
| PubChem CID | 134918831 |
| Molecular Formula | C19H30O3S |
| Molecular Weight | 338.51 g/mol |
| Exact Mass | 338.19 |
| IUPAC Name | tert-butyl (2R,3R)-3-hydroxy-2-(phenylsulfanylmethyl)octanoate |
| SMILES | CCCCC[C@@H](O)[C@@H](CSc1ccccc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H30O3S/c1-5-6-8-13-17(20)16(18(21)22-19(2,3)4)14-23-15-11-9-7-10-12-15/h7,9-12,16-17,20H,5-6,8,13-14H2,1-4H3/t16-,17-/m1/s1 |
| InChIKey | PTBJANXLQZSINC-IAGOWNOFSA-N |
| XLogP | 4.68 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.51 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|