C15H15Cl2N3O3S — CID 100667348
5-chloro-N-[(6-chloro-3-pyridinyl)methylsulfonyl]-2-(ethylamino)benzamide (PubChem CID 100667348) has the molecular formula C15H15Cl2N3O3S and a molecular weight of 388.28 g/mol. Its IUPAC name is 5-chloro-N-[(6-chloro-3-pyridinyl)methylsulfonyl]-2-(ethylamino)benzamide.
| Compound Name | 5-chloro-N-[(6-chloro-3-pyridinyl)methylsulfonyl]-2-(ethylamino)benzamide |
|---|---|
| PubChem CID | 100667348 |
| Molecular Formula | C15H15Cl2N3O3S |
| Molecular Weight | 388.28 g/mol |
| Exact Mass | 387.02 |
| IUPAC Name | 5-chloro-N-[(6-chloro-3-pyridinyl)methylsulfonyl]-2-(ethylamino)benzamide |
| SMILES | CCNc1ccc(Cl)cc1C(=O)NS(=O)(=O)Cc1ccc(Cl)nc1 |
| InChI | InChI=1S/C15H15Cl2N3O3S/c1-2-18-13-5-4-11(16)7-12(13)15(21)20-24(22,23)9-10-3-6-14(17)19-8-10/h3-8,18H,2,9H2,1H3,(H,20,21) |
| InChIKey | HMFWAZWDJOJJCS-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.28 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|