About [(3S)-3-methoxybutyl] 2-[4-[(R)-methylsulfinyl]phenyl]acetate
[(3S)-3-methoxybutyl] 2-[4-[(R)-methylsulfinyl]phenyl]acetate (PubChem CID 100667400) has the molecular formula C14H20O4S
and a molecular weight of 284.38 g/mol. Its IUPAC name is [(3S)-3-methoxybutyl] 2-[4-[(R)-methylsulfinyl]phenyl]acetate.
Molecular Properties
| Compound Name | [(3S)-3-methoxybutyl] 2-[4-[(R)-methylsulfinyl]phenyl]acetate |
| PubChem CID | 100667400 |
| Molecular Formula | C14H20O4S |
| Molecular Weight | 284.38 g/mol |
| Exact Mass | 284.11 |
| IUPAC Name | [(3S)-3-methoxybutyl] 2-[4-[(R)-methylsulfinyl]phenyl]acetate |
| SMILES | CO[C@@H](C)CCOC(=O)Cc1ccc([S@@](C)=O)cc1 |
| InChI | InChI=1S/C14H20O4S/c1-11(17-2)8-9-18-14(15)10-12-4-6-13(7-5-12)19(3)16/h4-7,11H,8-10H2,1-3H3/t11-,19+/m0/s1 |
| InChIKey | HVUUXRAKEZLWOU-JEOXALJRSA-N |
| XLogP | 1.93 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.38 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [(3S)-3-methoxybutyl] 2-[4-[(R)-methylsulfinyl]phenyl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3S)-3-methoxybutyl] 2-[4-[(R)-methylsulfinyl]phenyl]acetate?
The IUPAC name of [(3S)-3-methoxybutyl] 2-[4-[(R)-methylsulfinyl]phenyl]acetate (CID 100667400) is [(3S)-3-methoxybutyl] 2-[4-[(R)-methylsulfinyl]phenyl]acetate.
What is the SMILES notation for [(3S)-3-methoxybutyl] 2-[4-[(R)-methylsulfinyl]phenyl]acetate?
The canonical SMILES for [(3S)-3-methoxybutyl] 2-[4-[(R)-methylsulfinyl]phenyl]acetate is CO[C@@H](C)CCOC(=O)Cc1ccc([S@@](C)=O)cc1.
What is the InChIKey of [(3S)-3-methoxybutyl] 2-[4-[(R)-methylsulfinyl]phenyl]acetate?
The InChIKey is HVUUXRAKEZLWOU-JEOXALJRSA-N. The full InChI is InChI=1S/C14H20O4S/c1-11(17-2)8-9-18-14(15)10-12-4-6-13(7-5-12)19(3)16/h4-7,11H,8-10H2,1-3H3/t11-,19+/m0/s1.
What are the key properties of [(3S)-3-methoxybutyl] 2-[4-[(R)-methylsulfinyl]phenyl]acetate?
[(3S)-3-methoxybutyl] 2-[4-[(R)-methylsulfinyl]phenyl]acetate has a molecular weight of 284.38 g/mol, XLogP of 1.93, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(3S)-3-methoxybutyl] 2-[4-[(R)-methylsulfinyl]phenyl]acetate is sourced from PubChem (CID 100667400), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).