C21H27N3O3S — CID 100668764
4-[(3-methoxy-4-propan-2-yloxyphenyl)methylcarbamothioylamino]-N,N-dimethylbenzamide (PubChem CID 100668764) has the molecular formula C21H27N3O3S and a molecular weight of 401.53 g/mol. Its IUPAC name is 4-[(3-methoxy-4-propan-2-yloxyphenyl)methylcarbamothioylamino]-N,N-dimethylbenzamide.
| Compound Name | 4-[(3-methoxy-4-propan-2-yloxyphenyl)methylcarbamothioylamino]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 100668764 |
| Molecular Formula | C21H27N3O3S |
| Molecular Weight | 401.53 g/mol |
| Exact Mass | 401.18 |
| IUPAC Name | 4-[(3-methoxy-4-propan-2-yloxyphenyl)methylcarbamothioylamino]-N,N-dimethylbenzamide |
| SMILES | COc1cc(CNC(=S)Nc2ccc(C(=O)N(C)C)cc2)ccc1OC(C)C |
| InChI | InChI=1S/C21H27N3O3S/c1-14(2)27-18-11-6-15(12-19(18)26-5)13-22-21(28)23-17-9-7-16(8-10-17)20(25)24(3)4/h6-12,14H,13H2,1-5H3,(H2,22,23,28) |
| InChIKey | NLADADONBCYIMI-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.53 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|