C16H14FN5O2S — CID 10067004
7-(3-aminopyrrolidin-1-yl)-6-fluoro-4-oxo-1-(1,3-thiazol-2-yl)-1,8-naphthyridine-3-carbaldehyde (PubChem CID 10067004) has the molecular formula C16H14FN5O2S and a molecular weight of 359.39 g/mol. Its IUPAC name is 7-(3-aminopyrrolidin-1-yl)-6-fluoro-4-oxo-1-(1,3-thiazol-2-yl)-1,8-naphthyridine-3-carbaldehyde.
| Compound Name | 7-(3-aminopyrrolidin-1-yl)-6-fluoro-4-oxo-1-(1,3-thiazol-2-yl)-1,8-naphthyridine-3-carbaldehyde |
|---|---|
| PubChem CID | 10067004 |
| Molecular Formula | C16H14FN5O2S |
| Molecular Weight | 359.39 g/mol |
| Exact Mass | 359.09 |
| IUPAC Name | 7-(3-aminopyrrolidin-1-yl)-6-fluoro-4-oxo-1-(1,3-thiazol-2-yl)-1,8-naphthyridine-3-carbaldehyde |
| SMILES | NC1CCN(c2nc3c(cc2F)c(=O)c(C=O)cn3-c2nccs2)C1 |
| InChI | InChI=1S/C16H14FN5O2S/c17-12-5-11-13(24)9(8-23)6-22(16-19-2-4-25-16)14(11)20-15(12)21-3-1-10(18)7-21/h2,4-6,8,10H,1,3,7,18H2 |
| InChIKey | KXWQWZMJCRPAQI-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 94.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.39 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|