C20H18FN3OS — CID 10067543
N-(3,5-dimethylphenyl)-2-[(2-fluoro-4-pyridinyl)methylsulfanyl]pyridine-3-carboxamide (PubChem CID 10067543) has the molecular formula C20H18FN3OS and a molecular weight of 367.45 g/mol. Its IUPAC name is N-(3,5-dimethylphenyl)-2-[(2-fluoro-4-pyridinyl)methylsulfanyl]pyridine-3-carboxamide.
| Compound Name | N-(3,5-dimethylphenyl)-2-[(2-fluoro-4-pyridinyl)methylsulfanyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 10067543 |
| Molecular Formula | C20H18FN3OS |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | N-(3,5-dimethylphenyl)-2-[(2-fluoro-4-pyridinyl)methylsulfanyl]pyridine-3-carboxamide |
| SMILES | Cc1cc(C)cc(NC(=O)c2cccnc2SCc2ccnc(F)c2)c1 |
| InChI | InChI=1S/C20H18FN3OS/c1-13-8-14(2)10-16(9-13)24-19(25)17-4-3-6-23-20(17)26-12-15-5-7-22-18(21)11-15/h3-11H,12H2,1-2H3,(H,24,25) |
| InChIKey | AKWNVQJIFDXHQV-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|