C17H21FN2O3 — CID 100678163
3-[(1S,2S)-2-(4-fluorophenyl)cyclopentyl]-1-(2-methoxyethyl)imidazolidine-2,4-dione (PubChem CID 100678163) has the molecular formula C17H21FN2O3 and a molecular weight of 320.36 g/mol. Its IUPAC name is 3-[(1S,2S)-2-(4-fluorophenyl)cyclopentyl]-1-(2-methoxyethyl)imidazolidine-2,4-dione.
| Compound Name | 3-[(1S,2S)-2-(4-fluorophenyl)cyclopentyl]-1-(2-methoxyethyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 100678163 |
| Molecular Formula | C17H21FN2O3 |
| Molecular Weight | 320.36 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | 3-[(1S,2S)-2-(4-fluorophenyl)cyclopentyl]-1-(2-methoxyethyl)imidazolidine-2,4-dione |
| SMILES | COCCN1CC(=O)N([C@H]2CCC[C@H]2c2ccc(F)cc2)C1=O |
| InChI | InChI=1S/C17H21FN2O3/c1-23-10-9-19-11-16(21)20(17(19)22)15-4-2-3-14(15)12-5-7-13(18)8-6-12/h5-8,14-15H,2-4,9-11H2,1H3/t14-,15-/m0/s1 |
| InChIKey | ZBGKTENSDJNQIE-GJZGRUSLSA-N |
| XLogP | 2.37 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.36 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|