C14H10Cl2N2O4S — CID 10067923
N-(2,3-dichloro-6-sulfanylphenyl)-N-(4-methoxy-2-nitrophenyl)formamide (PubChem CID 10067923) has the molecular formula C14H10Cl2N2O4S and a molecular weight of 373.22 g/mol. Its IUPAC name is N-(2,3-dichloro-6-sulfanylphenyl)-N-(4-methoxy-2-nitrophenyl)formamide.
| Compound Name | N-(2,3-dichloro-6-sulfanylphenyl)-N-(4-methoxy-2-nitrophenyl)formamide |
|---|---|
| PubChem CID | 10067923 |
| Molecular Formula | C14H10Cl2N2O4S |
| Molecular Weight | 373.22 g/mol |
| Exact Mass | 371.97 |
| IUPAC Name | N-(2,3-dichloro-6-sulfanylphenyl)-N-(4-methoxy-2-nitrophenyl)formamide |
| SMILES | COc1ccc(N(C=O)c2c(S)ccc(Cl)c2Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H10Cl2N2O4S/c1-22-8-2-4-10(11(6-8)18(20)21)17(7-19)14-12(23)5-3-9(15)13(14)16/h2-7,23H,1H3 |
| InChIKey | ZUOVOQXBBIZDNQ-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 72.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.22 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|