C16H31ISi — CID 10068219
[(Z)-2-[(1S,2R)-1-(2,2-dimethylpropyl)-2-(iodomethyl)cyclopentyl]ethenyl]-trimethylsilane (PubChem CID 10068219) has the molecular formula C16H31ISi and a molecular weight of 378.41 g/mol. Its IUPAC name is [(Z)-2-[(1S,2R)-1-(2,2-dimethylpropyl)-2-(iodomethyl)cyclopentyl]ethenyl]-trimethylsilane.
| Compound Name | [(Z)-2-[(1S,2R)-1-(2,2-dimethylpropyl)-2-(iodomethyl)cyclopentyl]ethenyl]-trimethylsilane |
|---|---|
| PubChem CID | 10068219 |
| Molecular Formula | C16H31ISi |
| Molecular Weight | 378.41 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | [(Z)-2-[(1S,2R)-1-(2,2-dimethylpropyl)-2-(iodomethyl)cyclopentyl]ethenyl]-trimethylsilane |
| SMILES | CC(C)(C)C[C@]1(/C=C\[Si](C)(C)C)CCC[C@H]1CI |
| InChI | InChI=1S/C16H31ISi/c1-15(2,3)13-16(10-11-18(4,5)6)9-7-8-14(16)12-17/h10-11,14H,7-9,12-13H2,1-6H3/b11-10-/t14-,16+/m0/s1 |
| InChIKey | MRLCNFGWMAYQRO-XKFLJWQCSA-N |
| XLogP | 6.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.41 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|